C12H11F2N3O2S — CID 103098114
N-(2,6-difluoro-3-pyridinyl)-2-pyridin-2-ylethanesulfonamide (PubChem CID 103098114) has the molecular formula C12H11F2N3O2S and a molecular weight of 299.30 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 103098114 |
| Molecular Formula | C12H11F2N3O2S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-pyridin-2-ylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccn1)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C12H11F2N3O2S/c13-11-5-4-10(12(14)16-11)17-20(18,19)8-6-9-3-1-2-7-15-9/h1-5,7,17H,6,8H2 |
| InChIKey | MUEMAKSCVCABHC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|