C13H14N2O4S2 — CID 25046544
methyl 4-(2-pyridin-2-ylethylsulfonylamino)thiophene-3-carboxylate (PubChem CID 25046544) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl 4-(2-pyridin-2-ylethylsulfonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-pyridin-2-ylethylsulfonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 25046544 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | methyl 4-(2-pyridin-2-ylethylsulfonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1cscc1NS(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C13H14N2O4S2/c1-19-13(16)11-8-20-9-12(11)15-21(17,18)7-5-10-4-2-3-6-14-10/h2-4,6,8-9,15H,5,7H2,1H3 |
| InChIKey | NWNHUWXKSGIMLU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |