C13H20N2O4S — CID 60864746
3,3-dimethyl-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid (PubChem CID 60864746) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3,3-dimethyl-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 60864746 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3,3-dimethyl-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid |
| SMILES | CC(C)(C)C(NS(=O)(=O)CCc1ccccn1)C(=O)O |
| InChI | InChI=1S/C13H20N2O4S/c1-13(2,3)11(12(16)17)15-20(18,19)9-7-10-6-4-5-8-14-10/h4-6,8,11,15H,7,9H2,1-3H3,(H,16,17) |
| InChIKey | HBZJJRAWBVUAPD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |