C11H15N3O5S — CID 63715727
(2S)-4-amino-4-oxo-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid (PubChem CID 63715727) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 63715727 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-(2-pyridin-2-ylethylsulfonylamino)butanoic acid |
| SMILES | NC(=O)C[C@H](NS(=O)(=O)CCc1ccccn1)C(=O)O |
| InChI | InChI=1S/C11H15N3O5S/c12-10(15)7-9(11(16)17)14-20(18,19)6-4-8-3-1-2-5-13-8/h1-3,5,9,14H,4,6-7H2,(H2,12,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | SGUMBDHIGXNUHI-VIFPVBQESA-N |
| XLogP | -1.13 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |