C11H16N2O4S2 — CID 114212692
2-(2-pyridin-2-ylethylsulfonylamino)-4-sulfanylbutanoic acid (PubChem CID 114212692) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethylsulfonylamino)-4-sulfanylbutanoic acid.
| Compound Name | 2-(2-pyridin-2-ylethylsulfonylamino)-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 114212692 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(2-pyridin-2-ylethylsulfonylamino)-4-sulfanylbutanoic acid |
| SMILES | O=C(O)C(CCS)NS(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C11H16N2O4S2/c14-11(15)10(4-7-18)13-19(16,17)8-5-9-3-1-2-6-12-9/h1-3,6,10,13,18H,4-5,7-8H2,(H,14,15) |
| InChIKey | XNOWYJMHMBDJLM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|