C14H12ClF3N2O2S — CID 3667629
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-pyridin-2-ylethanesulfonamide (PubChem CID 3667629) has the molecular formula C14H12ClF3N2O2S and a molecular weight of 364.78 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 3667629 |
| Molecular Formula | C14H12ClF3N2O2S |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-pyridin-2-ylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccn1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12ClF3N2O2S/c15-13-5-4-11(9-12(13)14(16,17)18)20-23(21,22)8-6-10-3-1-2-7-19-10/h1-5,7,9,20H,6,8H2 |
| InChIKey | RBJJNFZKCSXNHW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |