C11H13ClF3NO2S — CID 22201682
N-[4-chloro-3-(trifluoromethyl)phenyl]butane-1-sulfonamide (PubChem CID 22201682) has the molecular formula C11H13ClF3NO2S and a molecular weight of 315.74 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]butane-1-sulfonamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 22201682 |
| Molecular Formula | C11H13ClF3NO2S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13ClF3NO2S/c1-2-3-6-19(17,18)16-8-4-5-10(12)9(7-8)11(13,14)15/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | JNARIUCZHVPYFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |