C10H12F3NO2S — CID 60705439
N-[4-methyl-3-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 60705439) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is N-[4-methyl-3-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-methyl-3-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 60705439 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-[4-methyl-3-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO2S/c1-3-17(15,16)14-8-5-4-7(2)9(6-8)10(11,12)13/h4-6,14H,3H2,1-2H3 |
| InChIKey | GGOZLTFRWGRPAK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |