C14H20F3N — CID 63455402
N-(3,3-dimethylbutyl)-4-methyl-3-(trifluoromethyl)aniline (PubChem CID 63455402) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-4-methyl-3-(trifluoromethyl)aniline.
| Compound Name | N-(3,3-dimethylbutyl)-4-methyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 63455402 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-(3,3-dimethylbutyl)-4-methyl-3-(trifluoromethyl)aniline |
| SMILES | Cc1ccc(NCCC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C14H20F3N/c1-10-5-6-11(9-12(10)14(15,16)17)18-8-7-13(2,3)4/h5-6,9,18H,7-8H2,1-4H3 |
| InChIKey | BXWAPHUYTPYJRI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |