C8H7F2N3O2S — CID 103098247
1-cyano-N-(2,6-difluoro-3-pyridinyl)ethanesulfonamide (PubChem CID 103098247) has the molecular formula C8H7F2N3O2S and a molecular weight of 247.23 g/mol. Its IUPAC name is 1-cyano-N-(2,6-difluoro-3-pyridinyl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(2,6-difluoro-3-pyridinyl)ethanesulfonamide |
|---|---|
| PubChem CID | 103098247 |
| Molecular Formula | C8H7F2N3O2S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 1-cyano-N-(2,6-difluoro-3-pyridinyl)ethanesulfonamide |
| SMILES | CC(C#N)S(=O)(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C8H7F2N3O2S/c1-5(4-11)16(14,15)13-6-2-3-7(9)12-8(6)10/h2-3,5,13H,1H3 |
| InChIKey | QNHUBAZGDZQIKF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|