C11H13N3O3S — CID 75438949
2-(1-cyanoethylsulfonylamino)-N-methylbenzamide (PubChem CID 75438949) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(1-cyanoethylsulfonylamino)-N-methylbenzamide.
| Compound Name | 2-(1-cyanoethylsulfonylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 75438949 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(1-cyanoethylsulfonylamino)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1NS(=O)(=O)C(C)C#N |
| InChI | InChI=1S/C11H13N3O3S/c1-8(7-12)18(16,17)14-10-6-4-3-5-9(10)11(15)13-2/h3-6,8,14H,1-2H3,(H,13,15) |
| InChIKey | IBNLHYOAYZFLLV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |