C9H9N3O4S — CID 104740574
3-(1-cyanoethylsulfonylamino)pyridine-2-carboxylic acid (PubChem CID 104740574) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is 3-(1-cyanoethylsulfonylamino)pyridine-2-carboxylic acid.
| Compound Name | 3-(1-cyanoethylsulfonylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104740574 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 3-(1-cyanoethylsulfonylamino)pyridine-2-carboxylic acid |
| SMILES | CC(C#N)S(=O)(=O)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C9H9N3O4S/c1-6(5-10)17(15,16)12-7-3-2-4-11-8(7)9(13)14/h2-4,6,12H,1H3,(H,13,14) |
| InChIKey | VWGDEEKIGLWERH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |