C6H7N5O2S — CID 114387990
1-cyano-N-(1,2,4-triazin-3-yl)ethanesulfonamide (PubChem CID 114387990) has the molecular formula C6H7N5O2S and a molecular weight of 213.22 g/mol. Its IUPAC name is 1-cyano-N-(1,2,4-triazin-3-yl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(1,2,4-triazin-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 114387990 |
| Molecular Formula | C6H7N5O2S |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 1-cyano-N-(1,2,4-triazin-3-yl)ethanesulfonamide |
| SMILES | CC(C#N)S(=O)(=O)Nc1nccnn1 |
| InChI | InChI=1S/C6H7N5O2S/c1-5(4-7)14(12,13)11-6-8-2-3-9-10-6/h2-3,5H,1H3,(H,8,10,11) |
| InChIKey | RZRGTWPUANUOIH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |