C7H10N4O2S — CID 104620948
1-cyano-N-(4-methyl-1H-pyrazol-5-yl)ethanesulfonamide (PubChem CID 104620948) has the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-cyano-N-(4-methyl-1H-pyrazol-5-yl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(4-methyl-1H-pyrazol-5-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 104620948 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-cyano-N-(4-methyl-1H-pyrazol-5-yl)ethanesulfonamide |
| SMILES | Cc1cn[nH]c1NS(=O)(=O)C(C)C#N |
| InChI | InChI=1S/C7H10N4O2S/c1-5-4-9-10-7(5)11-14(12,13)6(2)3-8/h4,6H,1-2H3,(H2,9,10,11) |
| InChIKey | WIUWHKXAHNADRC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |