C8H12N4O2S — CID 102805691
1-cyano-N-(1,3-dimethylpyrazol-4-yl)ethanesulfonamide (PubChem CID 102805691) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 1-cyano-N-(1,3-dimethylpyrazol-4-yl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(1,3-dimethylpyrazol-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 102805691 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-cyano-N-(1,3-dimethylpyrazol-4-yl)ethanesulfonamide |
| SMILES | Cc1nn(C)cc1NS(=O)(=O)C(C)C#N |
| InChI | InChI=1S/C8H12N4O2S/c1-6(4-9)15(13,14)11-8-5-12(3)10-7(8)2/h5-6,11H,1-3H3 |
| InChIKey | KZJPDFVJYCANRF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |