C11H16N4O — CID 102805652
2-cyano-N-(1,3-dimethylpyrazol-4-yl)-3-methylbutanamide (PubChem CID 102805652) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-cyano-N-(1,3-dimethylpyrazol-4-yl)-3-methylbutanamide.
| Compound Name | 2-cyano-N-(1,3-dimethylpyrazol-4-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 102805652 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-cyano-N-(1,3-dimethylpyrazol-4-yl)-3-methylbutanamide |
| SMILES | Cc1nn(C)cc1NC(=O)C(C#N)C(C)C |
| InChI | InChI=1S/C11H16N4O/c1-7(2)9(5-12)11(16)13-10-6-15(4)14-8(10)3/h6-7,9H,1-4H3,(H,13,16) |
| InChIKey | CYXRDBZAGPAODC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |