C8H14N4O2S — CID 104620883
N-(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-sulfonamide (PubChem CID 104620883) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 104620883 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-sulfonamide |
| SMILES | Cc1cn[nH]c1NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C8H14N4O2S/c1-7-6-9-10-8(7)11-15(13,14)12-4-2-3-5-12/h6H,2-5H2,1H3,(H2,9,10,11) |
| InChIKey | GIXDVLBGSQXPRI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |