C11H9N5O2S — CID 114387989
1-(2-cyanophenyl)-N-(1,2,4-triazin-3-yl)methanesulfonamide (PubChem CID 114387989) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-(1,2,4-triazin-3-yl)methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-(1,2,4-triazin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 114387989 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 1-(2-cyanophenyl)-N-(1,2,4-triazin-3-yl)methanesulfonamide |
| SMILES | N#Cc1ccccc1CS(=O)(=O)Nc1nccnn1 |
| InChI | InChI=1S/C11H9N5O2S/c12-7-9-3-1-2-4-10(9)8-19(17,18)16-11-13-5-6-14-15-11/h1-6H,8H2,(H,13,15,16) |
| InChIKey | ZUYNHLRKWYJQNM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |