C13H10FN3O2S — CID 107595131
1-(2-cyanophenyl)-N-(3-fluoro-4-pyridinyl)methanesulfonamide (PubChem CID 107595131) has the molecular formula C13H10FN3O2S and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-(3-fluoro-4-pyridinyl)methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-(3-fluoro-4-pyridinyl)methanesulfonamide |
|---|---|
| PubChem CID | 107595131 |
| Molecular Formula | C13H10FN3O2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-(2-cyanophenyl)-N-(3-fluoro-4-pyridinyl)methanesulfonamide |
| SMILES | N#Cc1ccccc1CS(=O)(=O)Nc1ccncc1F |
| InChI | InChI=1S/C13H10FN3O2S/c14-12-8-16-6-5-13(12)17-20(18,19)9-11-4-2-1-3-10(11)7-15/h1-6,8H,9H2,(H,16,17) |
| InChIKey | BJZAVVAHNQQMBO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |