C12H11N3O2S2 — CID 63823577
1-(2-cyanophenyl)-N-(1,3-thiazol-4-ylmethyl)methanesulfonamide (PubChem CID 63823577) has the molecular formula C12H11N3O2S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-(1,3-thiazol-4-ylmethyl)methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-(1,3-thiazol-4-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 63823577 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 1-(2-cyanophenyl)-N-(1,3-thiazol-4-ylmethyl)methanesulfonamide |
| SMILES | N#Cc1ccccc1CS(=O)(=O)NCc1cscn1 |
| InChI | InChI=1S/C12H11N3O2S2/c13-5-10-3-1-2-4-11(10)8-19(16,17)15-6-12-7-18-9-14-12/h1-4,7,9,15H,6,8H2 |
| InChIKey | CGEVMILVDVPARV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |