C12H14N2O3S2 — CID 122558057
2-phenoxy-N-(1,3-thiazol-4-ylmethyl)ethanesulfonamide (PubChem CID 122558057) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-phenoxy-N-(1,3-thiazol-4-ylmethyl)ethanesulfonamide.
| Compound Name | 2-phenoxy-N-(1,3-thiazol-4-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 122558057 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-phenoxy-N-(1,3-thiazol-4-ylmethyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccccc1)NCc1cscn1 |
| InChI | InChI=1S/C12H14N2O3S2/c15-19(16,14-8-11-9-18-10-13-11)7-6-17-12-4-2-1-3-5-12/h1-5,9-10,14H,6-8H2 |
| InChIKey | AFRGBIOAPOMUOS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |