C8H13ClN2O2S2 — CID 79586158
3-chloro-2-methyl-N-(1,3-thiazol-4-ylmethyl)propane-1-sulfonamide (PubChem CID 79586158) has the molecular formula C8H13ClN2O2S2 and a molecular weight of 268.79 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(1,3-thiazol-4-ylmethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-(1,3-thiazol-4-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 79586158 |
| Molecular Formula | C8H13ClN2O2S2 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 3-chloro-2-methyl-N-(1,3-thiazol-4-ylmethyl)propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NCc1cscn1 |
| InChI | InChI=1S/C8H13ClN2O2S2/c1-7(2-9)5-15(12,13)11-3-8-4-14-6-10-8/h4,6-7,11H,2-3,5H2,1H3 |
| InChIKey | WHASHGXWUFKBGU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|