C11H12N2O2S2 — CID 49458470
3-methyl-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide (PubChem CID 49458470) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-methyl-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 3-methyl-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 49458470 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-methyl-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCc2cscn2)c1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-9-3-2-4-11(5-9)17(14,15)13-6-10-7-16-8-12-10/h2-5,7-8,13H,6H2,1H3 |
| InChIKey | PGEQNFQZBBRFDN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |