C10H10ClN3O2S2 — CID 113288438
4-amino-3-chloro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide (PubChem CID 113288438) has the molecular formula C10H10ClN3O2S2 and a molecular weight of 303.80 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 4-amino-3-chloro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113288438 |
| Molecular Formula | C10H10ClN3O2S2 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 4-amino-3-chloro-N-(1,3-thiazol-4-ylmethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCc2cscn2)cc1Cl |
| InChI | InChI=1S/C10H10ClN3O2S2/c11-9-3-8(1-2-10(9)12)18(15,16)14-4-7-5-17-6-13-7/h1-3,5-6,14H,4,12H2 |
| InChIKey | KMGAYGGUIBLTKK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|