C8H7ClN2O2S3 — CID 110717389
5-chloro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide (PubChem CID 110717389) has the molecular formula C8H7ClN2O2S3 and a molecular weight of 294.81 g/mol. Its IUPAC name is 5-chloro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110717389 |
| Molecular Formula | C8H7ClN2O2S3 |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 293.94 |
| IUPAC Name | 5-chloro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cscn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H7ClN2O2S3/c9-7-1-2-8(15-7)16(12,13)11-3-6-4-14-5-10-6/h1-2,4-5,11H,3H2 |
| InChIKey | ZZGGZNVBBSBOAD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |