C8H6ClN3O4S3 — CID 80741647
5-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide (PubChem CID 80741647) has the molecular formula C8H6ClN3O4S3 and a molecular weight of 339.81 g/mol. Its IUPAC name is 5-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80741647 |
| Molecular Formula | C8H6ClN3O4S3 |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | 5-chloro-4-nitro-N-(1,3-thiazol-4-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2cscn2)sc1Cl |
| InChI | InChI=1S/C8H6ClN3O4S3/c9-8-6(12(13)14)1-7(18-8)19(15,16)11-2-5-3-17-4-10-5/h1,3-4,11H,2H2 |
| InChIKey | LJOYREYROKSUDI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|