C10H9ClN2O4S3 — CID 80742321
5-chloro-N-[(4-methylthiophen-3-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80742321) has the molecular formula C10H9ClN2O4S3 and a molecular weight of 352.85 g/mol. Its IUPAC name is 5-chloro-N-[(4-methylthiophen-3-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(4-methylthiophen-3-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80742321 |
| Molecular Formula | C10H9ClN2O4S3 |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 5-chloro-N-[(4-methylthiophen-3-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1cscc1CNS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C10H9ClN2O4S3/c1-6-4-18-5-7(6)3-12-20(16,17)9-2-8(13(14)15)10(11)19-9/h2,4-5,12H,3H2,1H3 |
| InChIKey | LAGAYRIXUPQGGK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|