C8H7ClN4O5S2 — CID 80741842
5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80741842) has the molecular formula C8H7ClN4O5S2 and a molecular weight of 338.75 g/mol. Its IUPAC name is 5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80741842 |
| Molecular Formula | C8H7ClN4O5S2 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1noc(CNS(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)n1 |
| InChI | InChI=1S/C8H7ClN4O5S2/c1-4-11-6(18-12-4)3-10-20(16,17)7-2-5(13(14)15)8(9)19-7/h2,10H,3H2,1H3 |
| InChIKey | JBSIJAJUXWEVBK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|