C9H9ClN4O5S2 — CID 106415831
5-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 106415831) has the molecular formula C9H9ClN4O5S2 and a molecular weight of 352.78 g/mol. Its IUPAC name is 5-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106415831 |
| Molecular Formula | C9H9ClN4O5S2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 5-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)no1 |
| InChI | InChI=1S/C9H9ClN4O5S2/c1-5-12-7(13-19-5)2-3-11-21(17,18)8-4-6(14(15)16)9(10)20-8/h4,11H,2-3H2,1H3 |
| InChIKey | BDWZNNHAIMUBBE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|