C11H9ClN2O4S2 — CID 81098757
5-[[(5-chlorothiophen-2-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid (PubChem CID 81098757) has the molecular formula C11H9ClN2O4S2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 5-[[(5-chlorothiophen-2-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(5-chlorothiophen-2-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81098757 |
| Molecular Formula | C11H9ClN2O4S2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 5-[[(5-chlorothiophen-2-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNS(=O)(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C11H9ClN2O4S2/c12-9-3-4-10(19-9)20(17,18)14-6-7-1-2-8(11(15)16)13-5-7/h1-5,14H,6H2,(H,15,16) |
| InChIKey | JDVUHIOKKPRZAA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |