About 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid
5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid (PubChem CID 167756105) has the molecular formula C16H16N2O4S
and a molecular weight of 332.38 g/mol. Its IUPAC name is 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid |
| PubChem CID | 167756105 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNS(=O)(=O)C2Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C16H16N2O4S/c19-16(20)15-6-5-11(9-17-15)10-18-23(21,22)14-7-12-3-1-2-4-13(12)8-14/h1-6,9,14,18H,7-8,10H2,(H,19,20) |
| InChIKey | RBZUSUNPWVBHLK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid?
The IUPAC name of 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid (CID 167756105) is 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid is O=C(O)c1ccc(CNS(=O)(=O)C2Cc3ccccc3C2)cn1.
What is the InChIKey of 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid?
The InChIKey is RBZUSUNPWVBHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4S/c19-16(20)15-6-5-11(9-17-15)10-18-23(21,22)14-7-12-3-1-2-4-13(12)8-14/h1-6,9,14,18H,7-8,10H2,(H,19,20).
What are the key properties of 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid?
5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid has a molecular weight of 332.38 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dihydro-1H-inden-2-ylsulfonylamino)methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 167756105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).