C13H19N3O4S — CID 81092682
5-[[(3-methylpiperidin-1-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid (PubChem CID 81092682) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 5-[[(3-methylpiperidin-1-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(3-methylpiperidin-1-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81092682 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-[[(3-methylpiperidin-1-yl)sulfonylamino]methyl]pyridine-2-carboxylic acid |
| SMILES | CC1CCCN(S(=O)(=O)NCc2ccc(C(=O)O)nc2)C1 |
| InChI | InChI=1S/C13H19N3O4S/c1-10-3-2-6-16(9-10)21(19,20)15-8-11-4-5-12(13(17)18)14-7-11/h4-5,7,10,15H,2-3,6,8-9H2,1H3,(H,17,18) |
| InChIKey | QUMHBSSINHZQAK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |