C16H26N4O2S — CID 35323796
(3S)-3-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide (PubChem CID 35323796) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is (3S)-3-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide.
| Compound Name | (3S)-3-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 35323796 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (3S)-3-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide |
| SMILES | C[C@H]1CCCN(S(=O)(=O)NCc2ccnc(N3CCCC3)c2)C1 |
| InChI | InChI=1S/C16H26N4O2S/c1-14-5-4-10-20(13-14)23(21,22)18-12-15-6-7-17-16(11-15)19-8-2-3-9-19/h6-7,11,14,18H,2-5,8-10,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | GDCLBHDJNJCEDF-AWEZNQCLSA-N |
| XLogP | 1.75 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |