C19H34N4O2S — CID 47062228
ethane;4-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide (PubChem CID 47062228) has the molecular formula C19H34N4O2S and a molecular weight of 382.57 g/mol. Its IUPAC name is ethane;4-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide.
| Compound Name | ethane;4-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 47062228 |
| Molecular Formula | C19H34N4O2S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | ethane;4-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-sulfonamide |
| SMILES | CC.CC1CCN(S(=O)(=O)NCc2ccnc(N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C17H28N4O2S.C2H6/c1-15-6-11-21(12-7-15)24(22,23)19-14-16-5-8-18-17(13-16)20-9-3-2-4-10-20;1-2/h5,8,13,15,19H,2-4,6-7,9-12,14H2,1H3;1-2H3 |
| InChIKey | DAXQGJPVRKLFRE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |