C15H21N3O2S — CID 169029487
N-(1H-indol-5-ylmethyl)-4-methylpiperidine-1-sulfonamide (PubChem CID 169029487) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-4-methylpiperidine-1-sulfonamide.
| Compound Name | N-(1H-indol-5-ylmethyl)-4-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 169029487 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-4-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)NCc2ccc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-12-5-8-18(9-6-12)21(19,20)17-11-13-2-3-15-14(10-13)4-7-16-15/h2-4,7,10,12,16-17H,5-6,8-9,11H2,1H3 |
| InChIKey | CLGGSVGGNSXDIX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |