C11H19N3O2S — CID 106386114
4-methyl-N-(1H-pyrrol-3-ylmethyl)piperidine-1-sulfonamide (PubChem CID 106386114) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-methyl-N-(1H-pyrrol-3-ylmethyl)piperidine-1-sulfonamide.
| Compound Name | 4-methyl-N-(1H-pyrrol-3-ylmethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106386114 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-methyl-N-(1H-pyrrol-3-ylmethyl)piperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)NCc2cc[nH]c2)CC1 |
| InChI | InChI=1S/C11H19N3O2S/c1-10-3-6-14(7-4-10)17(15,16)13-9-11-2-5-12-8-11/h2,5,8,10,12-13H,3-4,6-7,9H2,1H3 |
| InChIKey | KOLRGXMSLFUCCM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |