C18H26N2 — CID 102911023
N-(1H-indol-6-ylmethyl)-2-(4-methylcyclohexyl)ethanamine (PubChem CID 102911023) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(1H-indol-6-ylmethyl)-2-(4-methylcyclohexyl)ethanamine.
| Compound Name | N-(1H-indol-6-ylmethyl)-2-(4-methylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 102911023 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-(1H-indol-6-ylmethyl)-2-(4-methylcyclohexyl)ethanamine |
| SMILES | CC1CCC(CCNCc2ccc3cc[nH]c3c2)CC1 |
| InChI | InChI=1S/C18H26N2/c1-14-2-4-15(5-3-14)8-10-19-13-16-6-7-17-9-11-20-18(17)12-16/h6-7,9,11-12,14-15,19-20H,2-5,8,10,13H2,1H3 |
| InChIKey | CYDFYZZCDNXIST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|