C17H27N3 — CID 102909156
N-(1H-indol-6-ylmethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 102909156) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-(1H-indol-6-ylmethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(1H-indol-6-ylmethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102909156 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-(1H-indol-6-ylmethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCc1ccc2cc[nH]c2c1)C(C)C |
| InChI | InChI=1S/C17H27N3/c1-13(2)20(14(3)4)10-9-18-12-15-5-6-16-7-8-19-17(16)11-15/h5-8,11,13-14,18-19H,9-10,12H2,1-4H3 |
| InChIKey | GNUNZPXAYQDGFX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|