C17H22N2 — CID 102911260
2,2-dicyclopropyl-N-(1H-indol-6-ylmethyl)ethanamine (PubChem CID 102911260) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2,2-dicyclopropyl-N-(1H-indol-6-ylmethyl)ethanamine.
| Compound Name | 2,2-dicyclopropyl-N-(1H-indol-6-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 102911260 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2,2-dicyclopropyl-N-(1H-indol-6-ylmethyl)ethanamine |
| SMILES | c1cc2ccc(CNCC(C3CC3)C3CC3)cc2[nH]1 |
| InChI | InChI=1S/C17H22N2/c1-2-15-7-8-19-17(15)9-12(1)10-18-11-16(13-3-4-13)14-5-6-14/h1-2,7-9,13-14,16,18-19H,3-6,10-11H2 |
| InChIKey | DZIUXFNGFKESSC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |