C15H23N5O2S — CID 87024756
4-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-2-piperidin-1-ylpyridine (PubChem CID 87024756) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-2-piperidin-1-ylpyridine.
| Compound Name | 4-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-2-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 87024756 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-2-piperidin-1-ylpyridine |
| SMILES | CN(CCC#N)S(=O)(=O)NCc1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C15H23N5O2S/c1-19(9-5-7-16)23(21,22)18-13-14-6-8-17-15(12-14)20-10-3-2-4-11-20/h6,8,12,18H,2-5,9-11,13H2,1H3 |
| InChIKey | PXPYVYOATYKREI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |