C12H17N3O3S — CID 47164741
1-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-3-methoxybenzene (PubChem CID 47164741) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-3-methoxybenzene.
| Compound Name | 1-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 47164741 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[[[2-cyanoethyl(methyl)sulfamoyl]amino]methyl]-3-methoxybenzene |
| SMILES | COc1cccc(CNS(=O)(=O)N(C)CCC#N)c1 |
| InChI | InChI=1S/C12H17N3O3S/c1-15(8-4-7-13)19(16,17)14-10-11-5-3-6-12(9-11)18-2/h3,5-6,9,14H,4,8,10H2,1-2H3 |
| InChIKey | HEHBIKWNSYNCFC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |