C11H10N2O4S2 — CID 54907517
5-(pyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 54907517) has the molecular formula C11H10N2O4S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-(pyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(pyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 54907517 |
| Molecular Formula | C11H10N2O4S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-(pyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCc2ccncc2)s1 |
| InChI | InChI=1S/C11H10N2O4S2/c14-11(15)9-1-2-10(18-9)19(16,17)13-7-8-3-5-12-6-4-8/h1-6,13H,7H2,(H,14,15) |
| InChIKey | XAMSZYMDUMCFRB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |