C10H11N3O4S2 — CID 61462775
5-(2-pyrazol-1-ylethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 61462775) has the molecular formula C10H11N3O4S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-(2-pyrazol-1-ylethylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(2-pyrazol-1-ylethylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61462775 |
| Molecular Formula | C10H11N3O4S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-(2-pyrazol-1-ylethylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCn2cccn2)s1 |
| InChI | InChI=1S/C10H11N3O4S2/c14-10(15)8-2-3-9(18-8)19(16,17)12-5-7-13-6-1-4-11-13/h1-4,6,12H,5,7H2,(H,14,15) |
| InChIKey | XVEIBBYIJAVTIB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |