C9H10N4O4S2 — CID 113412441
5-[2-(triazol-1-yl)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 113412441) has the molecular formula C9H10N4O4S2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 5-[2-(triazol-1-yl)ethylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-(triazol-1-yl)ethylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 113412441 |
| Molecular Formula | C9H10N4O4S2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5-[2-(triazol-1-yl)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCn2ccnn2)s1 |
| InChI | InChI=1S/C9H10N4O4S2/c14-9(15)7-1-2-8(18-7)19(16,17)11-4-6-13-5-3-10-12-13/h1-3,5,11H,4,6H2,(H,14,15) |
| InChIKey | MMXFKRAACXFTKQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |