C9H12N4O3S2 — CID 114135368
5-(hydroxymethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 114135368) has the molecular formula C9H12N4O3S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114135368 |
| Molecular Formula | C9H12N4O3S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-(hydroxymethyl)-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCn1ccnn1)c1csc(CO)c1 |
| InChI | InChI=1S/C9H12N4O3S2/c14-6-8-5-9(7-17-8)18(15,16)11-2-4-13-3-1-10-12-13/h1,3,5,7,11,14H,2,4,6H2 |
| InChIKey | WBFZMZIWBAMQHD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |