C12H17N5O2S2 — CID 106077237
2-[(cyclopropylamino)methyl]-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 106077237) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106077237 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-N-[2-(triazol-1-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCn1ccnn1)c1ccsc1CNC1CC1 |
| InChI | InChI=1S/C12H17N5O2S2/c18-21(19,15-5-7-17-6-4-14-16-17)12-3-8-20-11(12)9-13-10-1-2-10/h3-4,6,8,10,13,15H,1-2,5,7,9H2 |
| InChIKey | PGOCHPDOXVLNTI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |