C12H15F3N2O2S2 — CID 106218686
2-[(cyclopropylamino)methyl]-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-sulfonamide (PubChem CID 106218686) has the molecular formula C12H15F3N2O2S2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-sulfonamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106218686 |
| Molecular Formula | C12H15F3N2O2S2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1(C(F)(F)F)CC1)c1ccsc1CNC1CC1 |
| InChI | InChI=1S/C12H15F3N2O2S2/c13-12(14,15)11(4-5-11)17-21(18,19)10-3-6-20-9(10)7-16-8-1-2-8/h3,6,8,16-17H,1-2,4-5,7H2 |
| InChIKey | QXGUJMUWQKJPQC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |