C14H20N2O3S2 — CID 106072832
2-[(cyclopropylamino)methyl]-N-(7-oxabicyclo[2.2.1]heptan-2-yl)thiophene-3-sulfonamide (PubChem CID 106072832) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-N-(7-oxabicyclo[2.2.1]heptan-2-yl)thiophene-3-sulfonamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-N-(7-oxabicyclo[2.2.1]heptan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106072832 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-N-(7-oxabicyclo[2.2.1]heptan-2-yl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1CC2CCC1O2)c1ccsc1CNC1CC1 |
| InChI | InChI=1S/C14H20N2O3S2/c17-21(18,16-11-7-10-3-4-12(11)19-10)14-5-6-20-13(14)8-15-9-1-2-9/h5-6,9-12,15-16H,1-4,7-8H2 |
| InChIKey | RAGXZIFXWKAHFN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |