C11H11ClN4O4S — CID 107090248
2-chloro-4-[2-(triazol-1-yl)ethylsulfamoyl]benzoic acid (PubChem CID 107090248) has the molecular formula C11H11ClN4O4S and a molecular weight of 330.75 g/mol. Its IUPAC name is 2-chloro-4-[2-(triazol-1-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 2-chloro-4-[2-(triazol-1-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 107090248 |
| Molecular Formula | C11H11ClN4O4S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2-chloro-4-[2-(triazol-1-yl)ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCn2ccnn2)cc1Cl |
| InChI | InChI=1S/C11H11ClN4O4S/c12-10-7-8(1-2-9(10)11(17)18)21(19,20)14-4-6-16-5-3-13-15-16/h1-3,5,7,14H,4,6H2,(H,17,18) |
| InChIKey | WMRWBTOJSBUDMJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |