C12H13N3O5S — CID 61463014
2-hydroxy-5-(2-pyrazol-1-ylethylsulfamoyl)benzoic acid (PubChem CID 61463014) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-hydroxy-5-(2-pyrazol-1-ylethylsulfamoyl)benzoic acid.
| Compound Name | 2-hydroxy-5-(2-pyrazol-1-ylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 61463014 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-hydroxy-5-(2-pyrazol-1-ylethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCn2cccn2)ccc1O |
| InChI | InChI=1S/C12H13N3O5S/c16-11-3-2-9(8-10(11)12(17)18)21(19,20)14-5-7-15-6-1-4-13-15/h1-4,6,8,14,16H,5,7H2,(H,17,18) |
| InChIKey | LRNDMMOPABQIQO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |